C12H15N3O3S2 — CID 3985063
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 3985063) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3985063 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | Cc1ccc(NC(=O)CSC(=S)N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-8-4-5-9(10(6-8)15(17)18)13-11(16)7-20-12(19)14(2)3/h4-6H,7H2,1-3H3,(H,13,16) |
| InChIKey | SZIVTDUAIRZJBP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|