C11H14N2O2S2 — CID 2140174
[2-(2-hydroxyanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 2140174) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is [2-(2-hydroxyanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-(2-hydroxyanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 2140174 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | [2-(2-hydroxyanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCC(=O)Nc1ccccc1O |
| InChI | InChI=1S/C11H14N2O2S2/c1-13(2)11(16)17-7-10(15)12-8-5-3-4-6-9(8)14/h3-6,14H,7H2,1-2H3,(H,12,15) |
| InChIKey | QGYFSSGYMDSNPM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|