C19H22N2OS3 — CID 7841574
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] N,N-diethylcarbamodithioate (PubChem CID 7841574) has the molecular formula C19H22N2OS3 and a molecular weight of 390.60 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7841574 |
| Molecular Formula | C19H22N2OS3 |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C19H22N2OS3/c1-3-21(4-2)19(23)24-14-18(22)20-16-12-8-9-13-17(16)25-15-10-6-5-7-11-15/h5-13H,3-4,14H2,1-2H3,(H,20,22) |
| InChIKey | OHVUOSSKURJAQO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|