C13H16F2N2OS2 — CID 8818244
[2-(2,5-difluoroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8818244) has the molecular formula C13H16F2N2OS2 and a molecular weight of 318.41 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818244 |
| Molecular Formula | C13H16F2N2OS2 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C13H16F2N2OS2/c1-3-17(4-2)13(19)20-8-12(18)16-11-7-9(14)5-6-10(11)15/h5-7H,3-4,8H2,1-2H3,(H,16,18) |
| InChIKey | HVBDPPJFCKMGEP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|