C14H19N3O4S2 — CID 7841604
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 7841604) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7841604 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H19N3O4S2/c1-4-16(5-2)14(22)23-9-13(18)15-11-7-6-10(17(19)20)8-12(11)21-3/h6-8H,4-5,9H2,1-3H3,(H,15,18) |
| InChIKey | ALDWOEGXQCHFCA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|