C16H21N5O4S — CID 28564045
2-[(4-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 28564045) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[(4-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[(4-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 28564045 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[(4-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2OC)nnc1C(C)C |
| InChI | InChI=1S/C16H21N5O4S/c1-5-20-15(10(2)3)18-19-16(20)26-9-14(22)17-12-7-6-11(21(23)24)8-13(12)25-4/h6-8,10H,5,9H2,1-4H3,(H,17,22) |
| InChIKey | MYIGSXHNOFYXKV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|