C28H29N5O5S — CID 43867023
N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 43867023) has the molecular formula C28H29N5O5S and a molecular weight of 547.64 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 43867023 |
| Molecular Formula | C28H29N5O5S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CSc1nnc(C(C)Oc2ccc(C(C)C)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C28H29N5O5S/c1-18(2)20-10-13-23(14-11-20)38-19(3)27-30-31-28(32(27)21-8-6-5-7-9-21)39-17-26(34)29-24-16-22(33(35)36)12-15-25(24)37-4/h5-16,18-19H,17H2,1-4H3,(H,29,34) |
| InChIKey | QYIVQUSOUZSFAU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|