C27H28N4O3S — CID 43867098
N-(2-hydroxyphenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 43867098) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-hydroxyphenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 43867098 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-(2-hydroxyphenyl)-2-[[4-phenyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(C)c1ccc(OC(C)c2nnc(SCC(=O)Nc3ccccc3O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N4O3S/c1-18(2)20-13-15-22(16-14-20)34-19(3)26-29-30-27(31(26)21-9-5-4-6-10-21)35-17-25(33)28-23-11-7-8-12-24(23)32/h4-16,18-19,32H,17H2,1-3H3,(H,28,33) |
| InChIKey | KPWCTJLWXLLPOJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|