C15H20F2N2OS2 — CID 8818396
[2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8818396) has the molecular formula C15H20F2N2OS2 and a molecular weight of 346.47 g/mol. Its IUPAC name is [2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818396 |
| Molecular Formula | C15H20F2N2OS2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)N[C@@H](C)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2N2OS2/c1-4-19(5-2)15(21)22-9-14(20)18-10(3)12-7-6-11(16)8-13(12)17/h6-8,10H,4-5,9H2,1-3H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | YVSCXQYKRNQBNH-JTQLQIEISA-N |
| XLogP | 3.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|