C16H15F2NO2 — CID 78806063
N-[1-(2,4-difluorophenyl)ethyl]-2-(4-hydroxyphenyl)acetamide (PubChem CID 78806063) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 78806063 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-2-(4-hydroxyphenyl)acetamide |
| SMILES | CC(NC(=O)Cc1ccc(O)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F2NO2/c1-10(14-7-4-12(17)9-15(14)18)19-16(21)8-11-2-5-13(20)6-3-11/h2-7,9-10,20H,8H2,1H3,(H,19,21) |
| InChIKey | JZGSDJOGXUZLLR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |