6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid

C14H17F2NO3 — CID 60941112

IUPAC6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid
SMILESCC(NC(=O)CCCCC(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C14H17F2NO3/c1-9(11-7-6-10(15)8-12(11)16)17-13(18)4-2-3-5-14(19)20/h6-9H,2-5H2,1H3,(H,17,18)(H,19,20)
InChIKeyKSJCAHJCZMYEBR-UHFFFAOYSA-N
MW285.29 g/mol
LogP2.79
Rot. Bonds7

About 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid

6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid (PubChem CID 60941112) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid.

Molecular Properties

Compound Name6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid
PubChem CID60941112
Molecular FormulaC14H17F2NO3
Molecular Weight285.29 g/mol
Exact Mass285.12
IUPAC Name6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid
SMILESCC(NC(=O)CCCCC(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C14H17F2NO3/c1-9(11-7-6-10(15)8-12(11)16)17-13(18)4-2-3-5-14(19)20/h6-9H,2-5H2,1H3,(H,17,18)(H,19,20)
InChIKeyKSJCAHJCZMYEBR-UHFFFAOYSA-N
XLogP2.79
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.29
LogP ≤ 52.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid?
The IUPAC name of 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid (CID 60941112) is 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid.
What is the SMILES notation for 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid?
The canonical SMILES for 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid is CC(NC(=O)CCCCC(=O)O)c1ccc(F)cc1F.
What is the InChIKey of 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid?
The InChIKey is KSJCAHJCZMYEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-9(11-7-6-10(15)8-12(11)16)17-13(18)4-2-3-5-14(19)20/h6-9H,2-5H2,1H3,(H,17,18)(H,19,20).
What are the key properties of 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid?
6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid has a molecular weight of 285.29 g/mol, XLogP of 2.79, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(2,4-difluorophenyl)ethylamino]-6-oxohexanoic acid is sourced from PubChem (CID 60941112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).