C14H18FNO3 — CID 54867660
6-[1-(4-fluorophenyl)ethylamino]-6-oxohexanoic acid (PubChem CID 54867660) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 6-[1-(4-fluorophenyl)ethylamino]-6-oxohexanoic acid.
| Compound Name | 6-[1-(4-fluorophenyl)ethylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 54867660 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 6-[1-(4-fluorophenyl)ethylamino]-6-oxohexanoic acid |
| SMILES | CC(NC(=O)CCCCC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO3/c1-10(11-6-8-12(15)9-7-11)16-13(17)4-2-3-5-14(18)19/h6-10H,2-5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | DJMLUYPJCPTDKN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|