C13H19ClF2N2O — CID 119686258
N-[1-(2,4-difluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119686258) has the molecular formula C13H19ClF2N2O and a molecular weight of 292.76 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119686258 |
| Molecular Formula | C13H19ClF2N2O |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC(C)c1ccc(F)cc1F.Cl |
| InChI | InChI=1S/C13H18F2N2O.ClH/c1-9(17-13(18)4-3-7-16-2)11-6-5-10(14)8-12(11)15;/h5-6,8-9,16H,3-4,7H2,1-2H3,(H,17,18);1H |
| InChIKey | VAIZAPIKSSVONZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|