C19H23F2N3O3 — CID 8732700
N-[(1R)-1-(2,4-difluorophenyl)ethyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide (PubChem CID 8732700) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-difluorophenyl)ethyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide.
| Compound Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
|---|---|
| PubChem CID | 8732700 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
| SMILES | C[C@@H](NC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H23F2N3O3/c1-12(14-7-6-13(20)11-15(14)21)22-16(25)5-4-10-24-17(26)19(23-18(24)27)8-2-3-9-19/h6-7,11-12H,2-5,8-10H2,1H3,(H,22,25)(H,23,27)/t12-/m1/s1 |
| InChIKey | RHJGVSDOSUKZFO-GFCCVEGCSA-N |
| XLogP | 2.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|