C23H31N3O3 — CID 9396548
4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide (PubChem CID 9396548) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide.
| Compound Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 9396548 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide |
| SMILES | C[C@H](NC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H31N3O3/c1-16(18-11-10-17-7-2-3-8-19(17)15-18)24-20(27)9-6-14-26-21(28)23(25-22(26)29)12-4-5-13-23/h10-11,15-16H,2-9,12-14H2,1H3,(H,24,27)(H,25,29)/t16-/m0/s1 |
| InChIKey | KIJKGBINTBPGFP-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|