C27H32N2O3 — CID 40786470
7-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]heptanamide (PubChem CID 40786470) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 7-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]heptanamide.
| Compound Name | 7-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]heptanamide |
|---|---|
| PubChem CID | 40786470 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 7-(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]heptanamide |
| SMILES | C[C@H](NC(=O)CCCCCCN1C(=O)c2ccccc2C1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H32N2O3/c1-19(21-16-15-20-10-5-6-11-22(20)18-21)28-25(30)14-4-2-3-9-17-29-26(31)23-12-7-8-13-24(23)27(29)32/h7-8,12-13,15-16,18-19H,2-6,9-11,14,17H2,1H3,(H,28,30)/t19-/m0/s1 |
| InChIKey | DBIQHFCAMXCREQ-IBGZPJMESA-N |
| XLogP | 4.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|