C21H26N2O — CID 120608273
3-(2-aminophenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide (PubChem CID 120608273) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 120608273 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCc1ccccc1N)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H26N2O/c1-15(18-11-10-16-6-2-3-8-19(16)14-18)23-21(24)13-12-17-7-4-5-9-20(17)22/h4-5,7,9-11,14-15H,2-3,6,8,12-13,22H2,1H3,(H,23,24) |
| InChIKey | FGNPEFGVTFJEMY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|