C20H22ClNO — CID 133189162
3-(2-chlorophenyl)-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]propanamide (PubChem CID 133189162) has the molecular formula C20H22ClNO and a molecular weight of 327.86 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 133189162 |
| Molecular Formula | C20H22ClNO |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCc1ccccc1Cl)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H22ClNO/c1-14(17-10-9-15-6-4-7-18(15)13-17)22-20(23)12-11-16-5-2-3-8-19(16)21/h2-3,5,8-10,13-14H,4,6-7,11-12H2,1H3,(H,22,23) |
| InChIKey | IQKLSAAKRAOHHD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |