C22H25NO2 — CID 108795927
4-oxo-4-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide (PubChem CID 108795927) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-oxo-4-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide.
| Compound Name | 4-oxo-4-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 108795927 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-oxo-4-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]butanamide |
| SMILES | CC(NC(=O)CCC(=O)c1ccccc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H25NO2/c1-16(19-12-11-17-7-5-6-10-20(17)15-19)23-22(25)14-13-21(24)18-8-3-2-4-9-18/h2-4,8-9,11-12,15-16H,5-7,10,13-14H2,1H3,(H,23,25) |
| InChIKey | DWCQVDZIPJUPAW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |