C18H19ClFNO2 — CID 46674104
3-(2-chlorophenyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]propanamide (PubChem CID 46674104) has the molecular formula C18H19ClFNO2 and a molecular weight of 335.81 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 46674104 |
| Molecular Formula | C18H19ClFNO2 |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(C(C)NC(=O)CCc2ccccc2Cl)cc1F |
| InChI | InChI=1S/C18H19ClFNO2/c1-12(14-7-9-17(23-2)16(20)11-14)21-18(22)10-8-13-5-3-4-6-15(13)19/h3-7,9,11-12H,8,10H2,1-2H3,(H,21,22) |
| InChIKey | HIPIKFYIFFNZMC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |