C20H19ClFN3O2 — CID 18281965
1-[(2-chlorophenyl)methyl]-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyrazole-4-carboxamide (PubChem CID 18281965) has the molecular formula C20H19ClFN3O2 and a molecular weight of 387.84 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18281965 |
| Molecular Formula | C20H19ClFN3O2 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyrazole-4-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cnn(Cc3ccccc3Cl)c2)cc1F |
| InChI | InChI=1S/C20H19ClFN3O2/c1-13(14-7-8-19(27-2)18(22)9-14)24-20(26)16-10-23-25(12-16)11-15-5-3-4-6-17(15)21/h3-10,12-13H,11H2,1-2H3,(H,24,26) |
| InChIKey | BQHNRUKTUDSASC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |