C19H15Cl3FN3O — CID 25440796
1-[(2-chlorophenyl)methyl]-N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]pyrazole-4-carboxamide (PubChem CID 25440796) has the molecular formula C19H15Cl3FN3O and a molecular weight of 426.71 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25440796 |
| Molecular Formula | C19H15Cl3FN3O |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]pyrazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1cnn(Cc2ccccc2Cl)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl3FN3O/c1-11(14-6-18(23)17(22)7-16(14)21)25-19(27)13-8-24-26(10-13)9-12-4-2-3-5-15(12)20/h2-8,10-11H,9H2,1H3,(H,25,27)/t11-/m0/s1 |
| InChIKey | NFRGXNSTJKBTRP-NSHDSACASA-N |
| XLogP | 5.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|