C19H19Cl2FN2O2 — CID 112819236
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(2-methylpropanoylamino)benzamide (PubChem CID 112819236) has the molecular formula C19H19Cl2FN2O2 and a molecular weight of 397.28 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(2-methylpropanoylamino)benzamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 112819236 |
| Molecular Formula | C19H19Cl2FN2O2 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)NC(C)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2FN2O2/c1-10(2)18(25)24-13-6-4-12(5-7-13)19(26)23-11(3)14-8-17(22)16(21)9-15(14)20/h4-11H,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | HMKSJQKYXFYKII-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|