C14H12Cl2FN3O2 — CID 51150886
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 51150886) has the molecular formula C14H12Cl2FN3O2 and a molecular weight of 344.17 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 51150886 |
| Molecular Formula | C14H12Cl2FN3O2 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccc(=O)n(C)n1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2FN3O2/c1-7(8-5-11(17)10(16)6-9(8)15)18-14(22)12-3-4-13(21)20(2)19-12/h3-7H,1-2H3,(H,18,22) |
| InChIKey | NGZZJTRVTRKKDB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|