C14H19Cl2FN2O — CID 112799664
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(diethylamino)acetamide (PubChem CID 112799664) has the molecular formula C14H19Cl2FN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(diethylamino)acetamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 112799664 |
| Molecular Formula | C14H19Cl2FN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(diethylamino)acetamide |
| SMILES | CCN(CC)CC(=O)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2FN2O/c1-4-19(5-2)8-14(20)18-9(3)10-6-13(17)12(16)7-11(10)15/h6-7,9H,4-5,8H2,1-3H3,(H,18,20) |
| InChIKey | INWUYPZHXJMDEA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|