C19H17Cl2FN2O3 — CID 112831926
3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1,1-bis(furan-2-ylmethyl)urea (PubChem CID 112831926) has the molecular formula C19H17Cl2FN2O3 and a molecular weight of 411.26 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1,1-bis(furan-2-ylmethyl)urea.
| Compound Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1,1-bis(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 112831926 |
| Molecular Formula | C19H17Cl2FN2O3 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1,1-bis(furan-2-ylmethyl)urea |
| SMILES | CC(NC(=O)N(Cc1ccco1)Cc1ccco1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2FN2O3/c1-12(15-8-18(22)17(21)9-16(15)20)23-19(25)24(10-13-4-2-6-26-13)11-14-5-3-7-27-14/h2-9,12H,10-11H2,1H3,(H,23,25) |
| InChIKey | GCNUDUFTCBXMRT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|