C19H19Cl2FN2O3 — CID 55472456
3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-methylurea (PubChem CID 55472456) has the molecular formula C19H19Cl2FN2O3 and a molecular weight of 413.28 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-methylurea.
| Compound Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 55472456 |
| Molecular Formula | C19H19Cl2FN2O3 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-methylurea |
| SMILES | CC(NC(=O)N(C)CC1COc2ccccc2O1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2FN2O3/c1-11(13-7-16(22)15(21)8-14(13)20)23-19(25)24(2)9-12-10-26-17-5-3-4-6-18(17)27-12/h3-8,11-12H,9-10H2,1-2H3,(H,23,25) |
| InChIKey | OVJMZLCTKJWEEK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|