C14H19Cl2FN2O — CID 112831917
1-butyl-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methylurea (PubChem CID 112831917) has the molecular formula C14H19Cl2FN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is 1-butyl-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methylurea.
| Compound Name | 1-butyl-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 112831917 |
| Molecular Formula | C14H19Cl2FN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-butyl-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-methylurea |
| SMILES | CCCCN(C)C(=O)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2FN2O/c1-4-5-6-19(3)14(20)18-9(2)10-7-13(17)12(16)8-11(10)15/h7-9H,4-6H2,1-3H3,(H,18,20) |
| InChIKey | HZJZMYWTBDTTJI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|