C16H24Cl2FN — CID 115566984
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]octan-1-amine (PubChem CID 115566984) has the molecular formula C16H24Cl2FN and a molecular weight of 320.28 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]octan-1-amine.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]octan-1-amine |
|---|---|
| PubChem CID | 115566984 |
| Molecular Formula | C16H24Cl2FN |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]octan-1-amine |
| SMILES | CCCCCCCCNC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2FN/c1-3-4-5-6-7-8-9-20-12(2)13-10-16(19)15(18)11-14(13)17/h10-12,20H,3-9H2,1-2H3 |
| InChIKey | PICXKEXTQUZMCB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|