C13H17Cl2FN2O — CID 103529766
5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]pentanamide (PubChem CID 103529766) has the molecular formula C13H17Cl2FN2O and a molecular weight of 307.20 g/mol. Its IUPAC name is 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]pentanamide.
| Compound Name | 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]pentanamide |
|---|---|
| PubChem CID | 103529766 |
| Molecular Formula | C13H17Cl2FN2O |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]pentanamide |
| SMILES | CC(NCCCCC(N)=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2FN2O/c1-8(18-5-3-2-4-13(17)19)9-6-12(16)11(15)7-10(9)14/h6-8,18H,2-5H2,1H3,(H2,17,19) |
| InChIKey | SQJHJPAAIDMYEE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|