C14H17Cl2FN2O — CID 115706405
N-[2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]ethyl]cyclopropanecarboxamide (PubChem CID 115706405) has the molecular formula C14H17Cl2FN2O and a molecular weight of 319.21 g/mol. Its IUPAC name is N-[2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 115706405 |
| Molecular Formula | C14H17Cl2FN2O |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]ethyl]cyclopropanecarboxamide |
| SMILES | CC(NCCNC(=O)C1CC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2FN2O/c1-8(10-6-13(17)12(16)7-11(10)15)18-4-5-19-14(20)9-2-3-9/h6-9,18H,2-5H2,1H3,(H,19,20) |
| InChIKey | PWEFHXJVKUHLPA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|