C16H22Cl2FN — CID 63450527
N-(2-cyclohexylethyl)-1-(2,4-dichloro-5-fluorophenyl)ethanamine (PubChem CID 63450527) has the molecular formula C16H22Cl2FN and a molecular weight of 318.26 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-1-(2,4-dichloro-5-fluorophenyl)ethanamine.
| Compound Name | N-(2-cyclohexylethyl)-1-(2,4-dichloro-5-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 63450527 |
| Molecular Formula | C16H22Cl2FN |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-(2-cyclohexylethyl)-1-(2,4-dichloro-5-fluorophenyl)ethanamine |
| SMILES | CC(NCCC1CCCCC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2FN/c1-11(13-9-16(19)15(18)10-14(13)17)20-8-7-12-5-3-2-4-6-12/h9-12,20H,2-8H2,1H3 |
| InChIKey | BFCOTLRFUVVCAX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|