C14H19Cl2FN2 — CID 62975546
N'-cyclopropyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-N'-methylethane-1,2-diamine (PubChem CID 62975546) has the molecular formula C14H19Cl2FN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is N'-cyclopropyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62975546 |
| Molecular Formula | C14H19Cl2FN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N'-cyclopropyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-N'-methylethane-1,2-diamine |
| SMILES | CC(NCCN(C)C1CC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2FN2/c1-9(18-5-6-19(2)10-3-4-10)11-7-14(17)13(16)8-12(11)15/h7-10,18H,3-6H2,1-2H3 |
| InChIKey | BRAZPSCKNXTAIC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|