C14H13Cl3FNS — CID 106041218
N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,4-dichloro-5-fluorophenyl)ethanamine (PubChem CID 106041218) has the molecular formula C14H13Cl3FNS and a molecular weight of 352.69 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,4-dichloro-5-fluorophenyl)ethanamine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,4-dichloro-5-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 106041218 |
| Molecular Formula | C14H13Cl3FNS |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(2,4-dichloro-5-fluorophenyl)ethanamine |
| SMILES | CC(NCCc1ccc(Cl)s1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl3FNS/c1-8(10-6-13(18)12(16)7-11(10)15)19-5-4-9-2-3-14(17)20-9/h2-3,6-8,19H,4-5H2,1H3 |
| InChIKey | MEUQKBCNTIGMRG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|