C15H15Cl2F2NS — CID 115841882
N-[1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 115841882) has the molecular formula C15H15Cl2F2NS and a molecular weight of 350.26 g/mol. Its IUPAC name is N-[1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115841882 |
| Molecular Formula | C15H15Cl2F2NS |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)s1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C15H15Cl2F2NS/c1-2-5-20-14(6-9-3-4-15(17)21-9)10-7-13(19)11(16)8-12(10)18/h3-4,7-8,14,20H,2,5-6H2,1H3 |
| InChIKey | UNTJTDOHEXNADB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|