C16H19Cl2NS — CID 107102196
N-[1-(3-chloro-2-methylphenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 107102196) has the molecular formula C16H19Cl2NS and a molecular weight of 328.31 g/mol. Its IUPAC name is N-[1-(3-chloro-2-methylphenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3-chloro-2-methylphenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107102196 |
| Molecular Formula | C16H19Cl2NS |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[1-(3-chloro-2-methylphenyl)-2-(5-chlorothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)s1)c1cccc(Cl)c1C |
| InChI | InChI=1S/C16H19Cl2NS/c1-3-9-19-15(10-12-7-8-16(18)20-12)13-5-4-6-14(17)11(13)2/h4-8,15,19H,3,9-10H2,1-2H3 |
| InChIKey | YPDDOXMLAZYYFU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |