C14H20ClF2NO — CID 105008662
N-[1-(4-chloro-2,5-difluorophenyl)-2-propoxyethyl]propan-1-amine (PubChem CID 105008662) has the molecular formula C14H20ClF2NO and a molecular weight of 291.77 g/mol. Its IUPAC name is N-[1-(4-chloro-2,5-difluorophenyl)-2-propoxyethyl]propan-1-amine.
| Compound Name | N-[1-(4-chloro-2,5-difluorophenyl)-2-propoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 105008662 |
| Molecular Formula | C14H20ClF2NO |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[1-(4-chloro-2,5-difluorophenyl)-2-propoxyethyl]propan-1-amine |
| SMILES | CCCNC(COCCC)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H20ClF2NO/c1-3-5-18-14(9-19-6-4-2)10-7-13(17)11(15)8-12(10)16/h7-8,14,18H,3-6,9H2,1-2H3 |
| InChIKey | CDBHFJLOYKEDFF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|