C16H18ClF2NS — CID 115861199
1-(4-chloro-2,5-difluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 115861199) has the molecular formula C16H18ClF2NS and a molecular weight of 329.84 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 115861199 |
| Molecular Formula | C16H18ClF2NS |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCCNC(CCc1cccs1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C16H18ClF2NS/c1-2-7-20-16(6-5-11-4-3-8-21-11)12-9-15(19)13(17)10-14(12)18/h3-4,8-10,16,20H,2,5-7H2,1H3 |
| InChIKey | BOOGFVBKHYWASJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|