C18H21NS2 — CID 115860702
1-(1-benzothiophen-3-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 115860702) has the molecular formula C18H21NS2 and a molecular weight of 315.51 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 115860702 |
| Molecular Formula | C18H21NS2 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCCNC(CCc1cccs1)c1csc2ccccc12 |
| InChI | InChI=1S/C18H21NS2/c1-2-11-19-17(10-9-14-6-5-12-20-14)16-13-21-18-8-4-3-7-15(16)18/h3-8,12-13,17,19H,2,9-11H2,1H3 |
| InChIKey | SEBWDKNUWUFBAF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |