C16H23NS — CID 43497176
1-(1-benzothiophen-3-yl)-N-propylpentan-1-amine (PubChem CID 43497176) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-propylpentan-1-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 43497176 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-propylpentan-1-amine |
| SMILES | CCCCC(NCCC)c1csc2ccccc12 |
| InChI | InChI=1S/C16H23NS/c1-3-5-9-15(17-11-4-2)14-12-18-16-10-7-6-8-13(14)16/h6-8,10,12,15,17H,3-5,9,11H2,1-2H3 |
| InChIKey | LKCQCAXFUXJXGV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |