C14H15NS — CID 104995348
1-(1-benzothiophen-3-yl)-N-propylprop-2-yn-1-amine (PubChem CID 104995348) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-propylprop-2-yn-1-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-propylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 104995348 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-propylprop-2-yn-1-amine |
| SMILES | C#CC(NCCC)c1csc2ccccc12 |
| InChI | InChI=1S/C14H15NS/c1-3-9-15-13(4-2)12-10-16-14-8-6-5-7-11(12)14/h2,5-8,10,13,15H,3,9H2,1H3 |
| InChIKey | GUWLEIUOXGOAGF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|