C16H16ClNOS — CID 106684309
N-[1-benzothiophen-3-yl-(5-chlorofuran-2-yl)methyl]propan-1-amine (PubChem CID 106684309) has the molecular formula C16H16ClNOS and a molecular weight of 305.83 g/mol. Its IUPAC name is N-[1-benzothiophen-3-yl-(5-chlorofuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[1-benzothiophen-3-yl-(5-chlorofuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106684309 |
| Molecular Formula | C16H16ClNOS |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-[1-benzothiophen-3-yl-(5-chlorofuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)o1)c1csc2ccccc12 |
| InChI | InChI=1S/C16H16ClNOS/c1-2-9-18-16(13-7-8-15(17)19-13)12-10-20-14-6-4-3-5-11(12)14/h3-8,10,16,18H,2,9H2,1H3 |
| InChIKey | MLELARBLWUSKRN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |