C13H17NOS — CID 116953028
4-(1-benzothiophen-3-yl)-4-(methylamino)butan-1-ol (PubChem CID 116953028) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-4-(methylamino)butan-1-ol.
| Compound Name | 4-(1-benzothiophen-3-yl)-4-(methylamino)butan-1-ol |
|---|---|
| PubChem CID | 116953028 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-4-(methylamino)butan-1-ol |
| SMILES | CNC(CCCO)c1csc2ccccc12 |
| InChI | InChI=1S/C13H17NOS/c1-14-12(6-4-8-15)11-9-16-13-7-3-2-5-10(11)13/h2-3,5,7,9,12,14-15H,4,6,8H2,1H3 |
| InChIKey | SBSVQLZTPUATMR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |