C12H16N2S — CID 116948479
1-(1-benzothiophen-3-yl)-N-methylpropane-1,3-diamine (PubChem CID 116948479) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-methylpropane-1,3-diamine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116948479 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-methylpropane-1,3-diamine |
| SMILES | CNC(CCN)c1csc2ccccc12 |
| InChI | InChI=1S/C12H16N2S/c1-14-11(6-7-13)10-8-15-12-5-3-2-4-9(10)12/h2-5,8,11,14H,6-7,13H2,1H3 |
| InChIKey | MWMPHMGONUVDFA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |