C15H22N2S — CID 116905416
1-(1-benzothiophen-3-yl)-N,N,2-trimethylbutane-1,4-diamine (PubChem CID 116905416) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N,N,2-trimethylbutane-1,4-diamine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N,N,2-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116905416 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N,N,2-trimethylbutane-1,4-diamine |
| SMILES | CC(CCN)C(c1csc2ccccc12)N(C)C |
| InChI | InChI=1S/C15H22N2S/c1-11(8-9-16)15(17(2)3)13-10-18-14-7-5-4-6-12(13)14/h4-7,10-11,15H,8-9,16H2,1-3H3 |
| InChIKey | WVDYLMRZHPOURF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |