C17H23NS — CID 43485761
1-(1-benzothiophen-3-yl)-2-cyclohexyl-N-methylethanamine (PubChem CID 43485761) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-2-cyclohexyl-N-methylethanamine.
| Compound Name | 1-(1-benzothiophen-3-yl)-2-cyclohexyl-N-methylethanamine |
|---|---|
| PubChem CID | 43485761 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-2-cyclohexyl-N-methylethanamine |
| SMILES | CNC(CC1CCCCC1)c1csc2ccccc12 |
| InChI | InChI=1S/C17H23NS/c1-18-16(11-13-7-3-2-4-8-13)15-12-19-17-10-6-5-9-14(15)17/h5-6,9-10,12-13,16,18H,2-4,7-8,11H2,1H3 |
| InChIKey | XSVWBDMWYIKNEI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |