C16H20ClNS — CID 63775444
1-(2-chlorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 63775444) has the molecular formula C16H20ClNS and a molecular weight of 293.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 1-(2-chlorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 63775444 |
| Molecular Formula | C16H20ClNS |
| Molecular Weight | 293.86 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCCNC(CCc1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C16H20ClNS/c1-2-11-18-16(10-9-13-6-5-12-19-13)14-7-3-4-8-15(14)17/h3-8,12,16,18H,2,9-11H2,1H3 |
| InChIKey | QESBRGAEIQZDKC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |