C14H18ClN — CID 63655900
1-(2-chlorophenyl)-N-propylpent-4-yn-1-amine (PubChem CID 63655900) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-propylpent-4-yn-1-amine.
| Compound Name | 1-(2-chlorophenyl)-N-propylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 63655900 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-(2-chlorophenyl)-N-propylpent-4-yn-1-amine |
| SMILES | C#CCCC(NCCC)c1ccccc1Cl |
| InChI | InChI=1S/C14H18ClN/c1-3-5-10-14(16-11-4-2)12-8-6-7-9-13(12)15/h1,6-9,14,16H,4-5,10-11H2,2H3 |
| InChIKey | HMYZNHATLGSIFM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|