C14H20ClF2NO — CID 103149984
1-(2-chlorophenyl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine (PubChem CID 103149984) has the molecular formula C14H20ClF2NO and a molecular weight of 291.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine.
| Compound Name | 1-(2-chlorophenyl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 103149984 |
| Molecular Formula | C14H20ClF2NO |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine |
| SMILES | CCCNC(CCOCC(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClF2NO/c1-2-8-18-13(7-9-19-10-14(16)17)11-5-3-4-6-12(11)15/h3-6,13-14,18H,2,7-10H2,1H3 |
| InChIKey | RRLSEYKCHZDXEE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|