C14H23F2N3O — CID 103150032
3-[3-(2,2-difluoroethoxy)-1-(propylamino)propyl]-5-methylpyridin-2-amine (PubChem CID 103150032) has the molecular formula C14H23F2N3O and a molecular weight of 287.35 g/mol. Its IUPAC name is 3-[3-(2,2-difluoroethoxy)-1-(propylamino)propyl]-5-methylpyridin-2-amine.
| Compound Name | 3-[3-(2,2-difluoroethoxy)-1-(propylamino)propyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 103150032 |
| Molecular Formula | C14H23F2N3O |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 3-[3-(2,2-difluoroethoxy)-1-(propylamino)propyl]-5-methylpyridin-2-amine |
| SMILES | CCCNC(CCOCC(F)F)c1cc(C)cnc1N |
| InChI | InChI=1S/C14H23F2N3O/c1-3-5-18-12(4-6-20-9-13(15)16)11-7-10(2)8-19-14(11)17/h7-8,12-13,18H,3-6,9H2,1-2H3,(H2,17,19) |
| InChIKey | UGWIUJCNQSBPCH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|